CAS 1440535-69-2 is the registry number for 4-(4-Bromo-3-methylphenyl)-2,4-dihydro-3h-1,2,4-triazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-bromo-3-methylphenyl)-1H-1,2,4-triazol-5-one (CAS 1440535-69-2) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 4-(4-bromo-3-methylphenyl)-1H-1,2,4-triazol-5-one. InChIKey: RKOIQLZWXNNNTB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-(4-bromo-3-methylphenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | RKOIQLZWXNNNTB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C=NNC2=O)Br |
Computed by PubChem (NCBI)