Products 937665-72-0
CAS 937665-72-0 is the registry number for [3-(2-Bromophenyl)-1,2,4-oxadiazol-5-yl]methanamine, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg.
[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]methanamine (CAS 937665-72-0) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: [3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]methanamine. InChIKey: LNHOZECFPHEBQS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | [3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| InChIKey | LNHOZECFPHEBQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CN)Br |
Computed by PubChem (NCBI)