CAS 1310249-56-9 appears in our catalog under these names: 3-Bromo-6,7-dihydro-4h-cyclopenta[d]pyrazolo[1,5-a]pyrimidin-8(5h)-one, 95%, 5H-Cyclopenta[d]pyrazolo[1,5-a]pyrimidin-8-ol, 3-bromo-6,7-dihydro-, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
10-bromo-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (CAS 1310249-56-9) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 10-bromo-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one. InChIKey: TWOYDPCOCPDXLF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 10-bromo-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| InChIKey | TWOYDPCOCPDXLF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=C3C(=CNN3C2=O)Br |
Computed by PubChem (NCBI)