Products 1782586-34-8

CAS 1782586-34-8 is the registry number for 5-Bromo-1-methyl-1h-indazole-3-carboxylic acid amide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-1-methylindazole-3-carboxamide (CAS 1782586-34-8) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 5-bromo-1-methylindazole-3-carboxamide. InChIKey: XSRWMSRXZFBDLX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrN3O
Molecular weight254.08 g/mol
IUPAC name5-bromo-1-methylindazole-3-carboxamide
InChIKeyXSRWMSRXZFBDLX-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)Br)C(=N1)C(=O)N

Computed by PubChem (NCBI)