CAS 1249756-52-2 appears in our catalog under these names: [1-(4-Bromophenyl)-1h-1,2,3-triazol-4-yl]methanol, 96%, (1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
[1-(4-bromophenyl)triazol-4-yl]methanol (CAS 1249756-52-2) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: [1-(4-bromophenyl)triazol-4-yl]methanol. InChIKey: HUVXBOQZBOJHIZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | [1-(4-bromophenyl)triazol-4-yl]methanol |
| InChIKey | HUVXBOQZBOJHIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)CO)Br |
Computed by PubChem (NCBI)