Products 1092347-56-2
CAS 1092347-56-2 appears in our catalog under these names: 4-Chloro-6-methoxy-2,3-dihydro-1H-inden-1-one, 97%, 97%, 4-CHLORO-6-METHOXY-INDAN-1-ONE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-chloro-6-methoxy-2,3-dihydroinden-1-one (CAS 1092347-56-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 4-chloro-6-methoxy-2,3-dihydroinden-1-one. InChIKey: AXWJUEOGJHUJMW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 4-chloro-6-methoxy-2,3-dihydroinden-1-one |
| InChIKey | AXWJUEOGJHUJMW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC2=O)C(=C1)Cl |
Computed by PubChem (NCBI)