Products 1092350-02-1

CAS 1092350-02-1 appears in our catalog under these names: 2-Fluoro-6-methylbenzene-1-sulfonyl chloride, 98%, 2-Fluoro-6-methylbenzene-1-sulfonyl chloride, 98%, 98%, 2-Fluoro-6-methylbenzenesulfonyl chloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 50mg, 500mg, 2.5g, 5g.

Structural formula: {0} (CAS {1})

2-fluoro-6-methylbenzenesulfonyl chloride (CAS 1092350-02-1) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-fluoro-6-methylbenzenesulfonyl chloride. InChIKey: JFMJQYFCCNCOKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClFO2S
Molecular weight208.64 g/mol
IUPAC name2-fluoro-6-methylbenzenesulfonyl chloride
InChIKeyJFMJQYFCCNCOKQ-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)