Products 1092460-45-1
CAS 1092460-45-1 is the registry number for 7-(Morpholine-4-carbonyl)quinazolin-4(3h)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
7-(morpholine-4-carbonyl)-3H-quinazolin-4-one (CAS 1092460-45-1) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: 7-(morpholine-4-carbonyl)-3H-quinazolin-4-one. InChIKey: LYICZOWTRHRHKZ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 7-(morpholine-4-carbonyl)-3H-quinazolin-4-one |
| InChIKey | LYICZOWTRHRHKZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC3=C(C=C2)C(=O)NC=N3 |
Computed by PubChem (NCBI)