CAS 1786462-99-4 is the registry number for N-1,3-Benzodioxol-5-yl-2-cyano-3-(dimethylamino)acrylamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(dimethylamino)prop-2-enamide (CAS 1786462-99-4) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(dimethylamino)prop-2-enamide. InChIKey: QFAQORDCDBJRON-VQHVLOKHSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(dimethylamino)prop-2-enamide |
| InChIKey | QFAQORDCDBJRON-VQHVLOKHSA-N |
| SMILES | CN(C)/C=C(\C#N)/C(=O)NC1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)