CAS 2102408-76-2 is the registry number for 5-((4-Methoxy-1h-indol-3-yl)methyl)imidazolidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-[(4-methoxy-1H-indol-3-yl)methyl]imidazolidine-2,4-dione (CAS 2102408-76-2) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: 5-[(4-methoxy-1H-indol-3-yl)methyl]imidazolidine-2,4-dione. InChIKey: ZWGKWSDJTOZKOP-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 5-[(4-methoxy-1H-indol-3-yl)methyl]imidazolidine-2,4-dione |
| InChIKey | ZWGKWSDJTOZKOP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CN2)CC3C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)