CAS 5354-94-9 appears in our catalog under these names: Benzoyl-l-histidine, 95%, Benzoyl-l-histidine monohydrate, 96%, Benzoyl-L-histidine, 98+%, Bz–His–OH, Bz-L-His-OH. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, TCI. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
(2S)-2-benzamido-3-(1H-imidazol-5-yl)propanoic acid (CAS 5354-94-9) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: (2S)-2-benzamido-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: AUDPUFBIVWMAED-NSHDSACASA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | (2S)-2-benzamido-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | AUDPUFBIVWMAED-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CC2=CN=CN2)C(=O)O |
Computed by PubChem (NCBI)