Products 725711-31-9

CAS 725711-31-9 is the registry number for 5-Acetyl-6-amino-1-benzylpyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-acetyl-6-amino-1-benzylpyrimidine-2,4-dione (CAS 725711-31-9) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: 5-acetyl-6-amino-1-benzylpyrimidine-2,4-dione. InChIKey: OWYAXMSHYAJPHE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13N3O3
Molecular weight259.26 g/mol
IUPAC name5-acetyl-6-amino-1-benzylpyrimidine-2,4-dione
InChIKeyOWYAXMSHYAJPHE-UHFFFAOYSA-N
SMILESCC(=O)C1=C(N(C(=O)NC1=O)CC2=CC=CC=C2)N

Computed by PubChem (NCBI)