CAS 571150-40-8 appears in our catalog under these names: N1-(2-Methoxy-phenyl)-4-nitro-benzene-1,2-diamine, 95%, 1-N-(2-Methoxyphenyl)-4-nitrobenzene-1,2-diamine, 95%, 1-N-(2-Methoxyphenyl)-4-nitrobenzene-1,2-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
1-N-(2-methoxyphenyl)-4-nitrobenzene-1,2-diamine (CAS 571150-40-8) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: 1-N-(2-methoxyphenyl)-4-nitrobenzene-1,2-diamine. InChIKey: PENBNISQWFMXAN-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 1-N-(2-methoxyphenyl)-4-nitrobenzene-1,2-diamine |
| InChIKey | PENBNISQWFMXAN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC2=C(C=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)