Products 1092460-96-2

CAS 1092460-96-2 is the registry number for 3-[5-Fluoro-2-(trifluoromethoxy)phenyl]propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[5-fluoro-2-(trifluoromethoxy)phenyl]propanoic acid (CAS 1092460-96-2) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 3-[5-fluoro-2-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: XUEWSXAZPZIDIR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F4O3
Molecular weight252.16 g/mol
IUPAC name3-[5-fluoro-2-(trifluoromethoxy)phenyl]propanoic acid
InChIKeyXUEWSXAZPZIDIR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)CCC(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)