CAS 1235493-10-3 is the registry number for 2-(3-Fluoro-4-(2,2,2-trifluoroethoxy)phenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]acetic acid (CAS 1235493-10-3) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]acetic acid. InChIKey: MJRYYOXKQGKMIY-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]acetic acid |
| InChIKey | MJRYYOXKQGKMIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)OCC(F)(F)F |
Computed by PubChem (NCBI)