Products 1240256-80-7
CAS 1240256-80-7 appears in our catalog under these names: 3-[4-Fluoro-3-(trifluoromethoxy)phenyl]propionic acid, 95%, 3-(4-Fluoro-3-(trifluoromethoxy)phenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g.
3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1240256-80-7) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: RDAQINCBAFDESL-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | RDAQINCBAFDESL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)O)OC(F)(F)F)F |
Computed by PubChem (NCBI)