CAS 937602-64-7 is the registry number for 3-(2,2,3,3-Tetrafluoropropoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,2,3,3-tetrafluoropropoxy)benzoic acid (CAS 937602-64-7) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 3-(2,2,3,3-tetrafluoropropoxy)benzoic acid. InChIKey: DJHPUSYYAQOIPI-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 3-(2,2,3,3-tetrafluoropropoxy)benzoic acid |
| InChIKey | DJHPUSYYAQOIPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(C(F)F)(F)F)C(=O)O |
Computed by PubChem (NCBI)