Products 1261616-38-9

CAS 1261616-38-9 is the registry number for 3-(3-Fluoro-4-trifluoromethoxy-phenyl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1261616-38-9) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: LXSHYQCERIQBTK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F4O3
Molecular weight252.16 g/mol
IUPAC name3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoic acid
InChIKeyLXSHYQCERIQBTK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CCC(=O)O)F)OC(F)(F)F

Computed by PubChem (NCBI)