CAS 1197231-80-3 is the registry number for 3-Fluoro-4-(trifluoromethoxy)benzoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 1g.
Ethyl 3-fluoro-4-(trifluoromethoxy)benzoate (CAS 1197231-80-3) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: ethyl 3-fluoro-4-(trifluoromethoxy)benzoate. InChIKey: FLEYPLBDYOXBSF-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | ethyl 3-fluoro-4-(trifluoromethoxy)benzoate |
| InChIKey | FLEYPLBDYOXBSF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)OC(F)(F)F)F |
Computed by PubChem (NCBI)