CAS 1092461-26-1 is the registry number for 3-Ethoxy-2,6-difluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
3-ethoxy-2,6-difluorobenzamide (CAS 1092461-26-1) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 3-ethoxy-2,6-difluorobenzamide. InChIKey: CNQRSQFCHZMZTD-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 3-ethoxy-2,6-difluorobenzamide |
| InChIKey | CNQRSQFCHZMZTD-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)C(=O)N)F |
Computed by PubChem (NCBI)