CAS 1092507-07-7 appears in our catalog under these names: Ramelteon Impurity 2, 1,6,7,8-Tetrahydro-2H-indeno(5,4-b)furan-8-ol, 97%, 1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-ol, 97%, 97%, 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ol, 97%. Offered by: Chemat Brand, Hubei YoungXin, AmBeed, Chemat, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-ol (CAS 1092507-07-7) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-ol. InChIKey: ZLRZRPVAJJZTEI-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-ol |
| InChIKey | ZLRZRPVAJJZTEI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)