CAS 1092568-87-0 appears in our catalog under these names: 3-(5-HydroxypyriMidin-2-yl)benzoic acid Methyl ester, 97%, 97%, 3-(5-Hydroxypyrimidin-2-yl)benzoic acid methyl ester, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
Methyl 3-(5-hydroxypyrimidin-2-yl)benzoate (CAS 1092568-87-0) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: methyl 3-(5-hydroxypyrimidin-2-yl)benzoate. InChIKey: HMOOJGNQBDDOPX-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | methyl 3-(5-hydroxypyrimidin-2-yl)benzoate |
| InChIKey | HMOOJGNQBDDOPX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=NC=C(C=N2)O |
Computed by PubChem (NCBI)