CAS 1092712-21-4 is the registry number for 1-(2,3-Difluorophenyl)-2,2,2-trifluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(2,3-difluorophenyl)-2,2,2-trifluoroethanone (CAS 1092712-21-4) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(2,3-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: YJJOYDXULMKYLC-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | YJJOYDXULMKYLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)