Products 109342-18-9

CAS 109342-18-9 is the registry number for 1,2-Dihydrocyclobuta[a]naphthalene-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1,2-dihydrocyclobuta[a]naphthalene-1-carboxylic acid (CAS 109342-18-9) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 1,2-dihydrocyclobuta[a]naphthalene-1-carboxylic acid. InChIKey: RLCDVCTWILGTOX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10O2
Molecular weight198.22 g/mol
IUPAC name1,2-dihydrocyclobuta[a]naphthalene-1-carboxylic acid
InChIKeyRLCDVCTWILGTOX-UHFFFAOYSA-N
SMILESC1C(C2=C1C=CC3=CC=CC=C32)C(=O)O

Computed by PubChem (NCBI)