Products 1093430-18-2

CAS 1093430-18-2 is the registry number for 3-(3,5-Dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid (CAS 1093430-18-2) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid. InChIKey: ZJCNNCJYWFIMQY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14N2O2
Molecular weight182.22 g/mol
IUPAC name3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid
InChIKeyZJCNNCJYWFIMQY-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1)C)CC(C)C(=O)O

Computed by PubChem (NCBI)