CAS 1093430-18-2 is the registry number for 3-(3,5-Dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid (CAS 1093430-18-2) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid. InChIKey: ZJCNNCJYWFIMQY-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-2-methylpropanoic acid |
| InChIKey | ZJCNNCJYWFIMQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)CC(C)C(=O)O |
Computed by PubChem (NCBI)