CAS 1093642-04-6 appears in our catalog under these names: 5-(2H-1,3-Benzodioxol-5-yl)-1h-pyrazole-3-carboxylic acid, 95%, 5-(1,3-Benzodioxol-5-yl)-1H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid (CAS 1093642-04-6) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: LMXODXZANYFXPY-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | LMXODXZANYFXPY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NNC(=C3)C(=O)O |
Computed by PubChem (NCBI)