CAS 37804-34-5 appears in our catalog under these names: 2,4-Dioxo-3-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid, 95%, 2,4-Dioxo-3-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid, 98%, 2,4-Dioxo-3-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
2,4-dioxo-3-phenyl-1H-pyrimidine-5-carboxylic acid (CAS 37804-34-5) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 2,4-dioxo-3-phenyl-1H-pyrimidine-5-carboxylic acid. InChIKey: XPJCKTHELWCTTN-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 2,4-dioxo-3-phenyl-1H-pyrimidine-5-carboxylic acid |
| InChIKey | XPJCKTHELWCTTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=CNC2=O)C(=O)O |
Computed by PubChem (NCBI)