CAS 1465565-65-4 is the registry number for 7-Methyl-2-oxo-3,6-dihydropyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-2-oxo-3,6-dihydropyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid (CAS 1465565-65-4) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 7-methyl-2-oxo-3,6-dihydropyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid. InChIKey: XRERPVOZPOQJGE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 7-methyl-2-oxo-3,6-dihydropyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid |
| InChIKey | XRERPVOZPOQJGE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC3=C2OC(=O)N3)C(=O)O |
Computed by PubChem (NCBI)