CAS 27406-31-1 appears in our catalog under these names: MHY-1685, MHY–1685, 5-[(4-Hydroxyphenyl)methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione, 95%, 95%, MHY-1685, 99.84%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 10mM/1mL, 100 mg.
5-[(4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (CAS 27406-31-1) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 5-[(4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione. InChIKey: KSOJQSBHVKAHPC-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 5-[(4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| InChIKey | KSOJQSBHVKAHPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C2C(=O)NC(=O)NC2=O)O |
Computed by PubChem (NCBI)