Products 82552-86-1
CAS 82552-86-1 appears in our catalog under these names: 1-(4-Nitrophenyl)-1H-pyrrole-2-carboxylic acid, 1-(4-Nitrophenyl)-1H-pyrrole-2-carboxylic acid 97%, 1-(4-Nitrophenyl)-1h-pyrrole-2-carboxylic acid, 98%, 98%, 1-(4-nitrophenyl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 100mg.
1-(4-nitrophenyl)pyrrole-2-carboxylic acid (CAS 82552-86-1) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 1-(4-nitrophenyl)pyrrole-2-carboxylic acid. InChIKey: YCDWGNIQEQCQQW-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 1-(4-nitrophenyl)pyrrole-2-carboxylic acid |
| InChIKey | YCDWGNIQEQCQQW-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)