CAS 91135-77-2 appears in our catalog under these names: N-(4-METHYL-2-NITROPHENYL)MALEIMIDE, >95% (HPLC), 1-(4-Methyl-2-nitro-phenyl)-pyrrole-2,5-dione, 95%, 1-(4-Methyl-2-nitrophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95%. Offered by: TRC, Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg, 50mg, 5g, 1g, 10g, 250mg.
1-(4-methyl-2-nitrophenyl)pyrrole-2,5-dione (CAS 91135-77-2) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 1-(4-methyl-2-nitrophenyl)pyrrole-2,5-dione. InChIKey: BHSSXQLSMUDQIV-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 1-(4-methyl-2-nitrophenyl)pyrrole-2,5-dione |
| InChIKey | BHSSXQLSMUDQIV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=O)C=CC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)