Products 1094225-83-8
CAS 1094225-83-8 is the registry number for (2E)-3-(8-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(E)-3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid (CAS 1094225-83-8) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: (E)-3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid. InChIKey: HVJWZSYFHWNTIW-OWOJBTEDSA-N.
| Molecular formula | C11H9BrO4 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | (E)-3-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid |
| InChIKey | HVJWZSYFHWNTIW-OWOJBTEDSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)