CAS 1334499-95-4 is the registry number for 5-Bromo-4-carboxymethyl-2-chromanone, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetic acid (CAS 1334499-95-4) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: 2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetic acid. InChIKey: BATNSUNQCYYYJI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO4 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetic acid |
| InChIKey | BATNSUNQCYYYJI-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C=CC=C2Br)OC1=O)CC(=O)O |
Computed by PubChem (NCBI)