Products 1334499-95-4

CAS 1334499-95-4 is the registry number for 5-Bromo-4-carboxymethyl-2-chromanone, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetic acid (CAS 1334499-95-4) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: 2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetic acid. InChIKey: BATNSUNQCYYYJI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BrO4
Molecular weight285.09 g/mol
IUPAC name2-(5-bromo-2-oxo-3,4-dihydrochromen-4-yl)acetic acid
InChIKeyBATNSUNQCYYYJI-UHFFFAOYSA-N
SMILESC1C(C2=C(C=CC=C2Br)OC1=O)CC(=O)O

Computed by PubChem (NCBI)