Products 60395-85-9
CAS 60395-85-9 appears in our catalog under these names: Methyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 98%, Methyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 95%, Methyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 95%+, 95%+, Methyl 4-(4-bromophenyl)-2,4-dioxobutanoate, Methyl 4-(4-bromophenyl)-2,4-dioxobutanoate, 95%+. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
Methyl 4-(4-bromophenyl)-2,4-dioxobutanoate (CAS 60395-85-9) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: methyl 4-(4-bromophenyl)-2,4-dioxobutanoate. InChIKey: JLRNIIRSSQRNJQ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO4 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | methyl 4-(4-bromophenyl)-2,4-dioxobutanoate |
| InChIKey | JLRNIIRSSQRNJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-(4-bromophenyl)-2,4-dioxobutanoate, Methyl 4-bromo-a,g-dioxo-benzenebutanoate, Methyl 4-(4-bromophenyl)-2,4-dioxo-butanoate, methyl4-(4-bromophenyl)-2,4-dioxobutanoate, 4-(4-bromophenyl)-2,4-dioxo-butanoic acid methyl ester, 4-(4-Bromo-phenyl)-2-hydroxy-4-oxo-but-2-enoic acid methyl ester