CAS 1216363-82-4 is the registry number for (E)-3-(7-bromo-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)acrylic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(E)-3-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid (CAS 1216363-82-4) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: (E)-3-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid. InChIKey: REHUDSQVQZNPMP-OWOJBTEDSA-N.
| Molecular formula | C11H9BrO4 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | (E)-3-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid |
| InChIKey | REHUDSQVQZNPMP-OWOJBTEDSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)