CAS 874111-47-4 is the registry number for 3-Bromo-5,7-dimethoxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,7-dimethoxychromen-2-one (CAS 874111-47-4) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: 3-bromo-5,7-dimethoxychromen-2-one. InChIKey: MRFGVOXDFJYILX-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO4 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 3-bromo-5,7-dimethoxychromen-2-one |
| InChIKey | MRFGVOXDFJYILX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(C(=O)O2)Br)C(=C1)OC |
Computed by PubChem (NCBI)