Products 93618-22-5
CAS 93618-22-5 appears in our catalog under these names: Methyl 4-(3-bromophenyl)-2,4-dioxobutanoate, 95-<97%, Methyl 4-(3-bromophenyl)-2,4-dioxobutanoate, ≥97-<99%, 4-(3-Bromo-phenyl)-2,4-dioxo-butyric acid methyl ester, 97%. Offered by: Hoffman Fine Chemicals, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g, 500mg, 1g.
Methyl 4-(3-bromophenyl)-2,4-dioxobutanoate (CAS 93618-22-5) is a chemical compound with the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. IUPAC name: methyl 4-(3-bromophenyl)-2,4-dioxobutanoate. InChIKey: JEJFZQTXCRUDGB-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO4 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | methyl 4-(3-bromophenyl)-2,4-dioxobutanoate |
| InChIKey | JEJFZQTXCRUDGB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-(3-bromophenyl)-2,4-dioxobutanoate, 4-(3-Bromo-phenyl)-2,4-dioxo-butyric acid methyl ester, Methyl 3-bromo-a,g-dioxo-benzenebutanoate, JEJFZQTXCRUDGB-UHFFFAOYSA-N, methyl4-(3-bromophenyl)-2,4-dioxobutanoate, methyl 4-(3-bromophenyl)-2,4-dioxo-butanoate, 2,4-dioxo-4-(3-bromophenyl)-butyric acid methyl ester, 3-bromo-alpha,gamma-dioxo-benzenebutanoic acid methyl ester, 4-(3-Bromo-phenyl)-2-hydroxy-4-oxo-but-2-enoic acid methyl ester