Products 952959-45-4
CAS 952959-45-4 is the registry number for 4-(2,4-Dichlorophenyl)-1,3-thiazole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 10g.
4-(2,4-dichlorophenyl)-1,3-thiazole-2-carboxylic acid (CAS 952959-45-4) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: YQKHGPZHWHCTQT-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | YQKHGPZHWHCTQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)