Products 1094263-34-9
CAS 1094263-34-9 is the registry number for 2-(2-(Trifluoromethyl)phenyl)thiazole-4-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid (CAS 1094263-34-9) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid. InChIKey: YJWAUDFAZRYGQG-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | YJWAUDFAZRYGQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)