CAS 886366-98-9 appears in our catalog under these names: 4-(4-(Trifluoromethyl)phenyl)thiazole-2-carboxylic acid, 95-<97%, 4-(4-(Trifluoromethyl)phenyl)thiazole-2-carboxylic acid, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
4-[4-(trifluoromethyl)phenyl]-1,3-thiazole-2-carboxylic acid (CAS 886366-98-9) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]-1,3-thiazole-2-carboxylic acid. InChIKey: VPHQUMSAFIQECF-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]-1,3-thiazole-2-carboxylic acid |
| InChIKey | VPHQUMSAFIQECF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)