CAS 762287-51-4 is the registry number for 2-(4-(Trifluoromethyl)phenyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylic acid (CAS 762287-51-4) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylic acid. InChIKey: DSHZQLTWBMTKEW-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | DSHZQLTWBMTKEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)