Products 762287-51-4

CAS 762287-51-4 is the registry number for 2-(4-(Trifluoromethyl)phenyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylic acid (CAS 762287-51-4) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylic acid. InChIKey: DSHZQLTWBMTKEW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3NO2S
Molecular weight273.23 g/mol
IUPAC name2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylic acid
InChIKeyDSHZQLTWBMTKEW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC=C(S2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)