CAS 144061-16-5 appears in our catalog under these names: 2-[4-(Trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid, 96%, 2-(4-(Trifluoromethyl)phenyl)thiazole-4-carboxylic acid. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 2mg, 10mg.
2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid (CAS 144061-16-5) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid. InChIKey: NFDUVSSDGPDOLR-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | NFDUVSSDGPDOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)