CAS 1927749-27-6 is the registry number for Methyl 2-(2,4,6-trifluorophenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2,4,6-trifluorophenyl)-1,3-thiazole-4-carboxylate (CAS 1927749-27-6) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: methyl 2-(2,4,6-trifluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: NHDJFBWYNNFZGH-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | methyl 2-(2,4,6-trifluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | NHDJFBWYNNFZGH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=C(C=C(C=C2F)F)F |
Computed by PubChem (NCBI)