CAS 115311-32-5 appears in our catalog under these names: 2-[3-(Trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid, 95%, 2-(3-(Trifluoromethyl)phenyl)thiazole-4-carboxylic acid, 95+%, 2-(3-(Trifluoromethyl)phenyl)-1,3-thiazole-4-carboxylic acid, 2-[3-(Trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 500mg.
2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid (CAS 115311-32-5) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid. InChIKey: OMMDRDBAUFWKPT-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | OMMDRDBAUFWKPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)