Products 1094333-80-8
CAS 1094333-80-8 is the registry number for 3-(4-Chlorophenyl)-3-methyloxolane-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-chlorophenyl)-3-methyloxolane-2,5-dione (CAS 1094333-80-8) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-3-methyloxolane-2,5-dione. InChIKey: ZYWUQMSYUIXQMI-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-3-methyloxolane-2,5-dione |
| InChIKey | ZYWUQMSYUIXQMI-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)OC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)