Products 1094338-36-9
CAS 1094338-36-9 appears in our catalog under these names: Cyclopropyl(2,5-difluorophenyl)methanone, 97%, Cyclopropyl 2,5-difluorophenyl ketone, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(2,5-difluorophenyl)methanone (CAS 1094338-36-9) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: cyclopropyl-(2,5-difluorophenyl)methanone. InChIKey: IAZYMFGPONAALF-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | cyclopropyl-(2,5-difluorophenyl)methanone |
| InChIKey | IAZYMFGPONAALF-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)