Products 72216-02-5
CAS 72216-02-5 is the registry number for 1-(2,4-Difluorophenyl)-2-methylprop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-difluorophenyl)-2-methylprop-2-en-1-one (CAS 72216-02-5) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2-methylprop-2-en-1-one. InChIKey: SWJNTRFLKZKBNL-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2-methylprop-2-en-1-one |
| InChIKey | SWJNTRFLKZKBNL-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)