CAS 61317-71-3 is the registry number for 4,7-Difluoro-3-methyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-difluoro-3-methyl-2,3-dihydroinden-1-one (CAS 61317-71-3) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 4,7-difluoro-3-methyl-2,3-dihydroinden-1-one. InChIKey: VPUZXEGGNFLNNF-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 4,7-difluoro-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | VPUZXEGGNFLNNF-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(C=CC(=C12)F)F |
Computed by PubChem (NCBI)