Products 60131-34-2
CAS 60131-34-2 appears in our catalog under these names: Cyclopropyl 2,4-difluorophenyl ketone, 95%, Cyclopropyl 2，4–difluorophenyl ketone, CYCLOPROPYL(2,4-DIFLUOROPHENYL)METHANONE, 97%, 97%, Cyclopropyl 2,4-difluorophenyl ketone, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Cyclopropyl-(2,4-difluorophenyl)methanone (CAS 60131-34-2) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: cyclopropyl-(2,4-difluorophenyl)methanone. InChIKey: JHKCOBHJTXEYLV-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | cyclopropyl-(2,4-difluorophenyl)methanone |
| InChIKey | JHKCOBHJTXEYLV-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)