CAS 1571074-31-1 is the registry number for (3E)-4-(2,5-Difluorophenyl)but-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-4-(2,5-difluorophenyl)but-3-en-2-one (CAS 1571074-31-1) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: (E)-4-(2,5-difluorophenyl)but-3-en-2-one. InChIKey: FSJFTIKWMINGNS-NSCUHMNNSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (E)-4-(2,5-difluorophenyl)but-3-en-2-one |
| InChIKey | FSJFTIKWMINGNS-NSCUHMNNSA-N |
| SMILES | CC(=O)/C=C/C1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)